C13H26N2O2 — CID 79637274
1-amino-3-(3,3-dimethylbutoxy)cyclohexane-1-carboxamide (PubChem CID 79637274) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-amino-3-(3,3-dimethylbutoxy)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-(3,3-dimethylbutoxy)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79637274 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-amino-3-(3,3-dimethylbutoxy)cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)CCOC1CCCC(N)(C(N)=O)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-12(2,3)7-8-17-10-5-4-6-13(15,9-10)11(14)16/h10H,4-9,15H2,1-3H3,(H2,14,16) |
| InChIKey | YIZAGASQXIKPIX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |