C17H32N4 — CID 79639447
3-(4-butan-2-ylpiperazin-1-yl)-1-(propylamino)cyclopentane-1-carbonitrile (PubChem CID 79639447) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is 3-(4-butan-2-ylpiperazin-1-yl)-1-(propylamino)cyclopentane-1-carbonitrile.
| Compound Name | 3-(4-butan-2-ylpiperazin-1-yl)-1-(propylamino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79639447 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 3-(4-butan-2-ylpiperazin-1-yl)-1-(propylamino)cyclopentane-1-carbonitrile |
| SMILES | CCCNC1(C#N)CCC(N2CCN(C(C)CC)CC2)C1 |
| InChI | InChI=1S/C17H32N4/c1-4-8-19-17(14-18)7-6-16(13-17)21-11-9-20(10-12-21)15(3)5-2/h15-16,19H,4-13H2,1-3H3 |
| InChIKey | JGVYSRHULGRBNR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |