C14H28N4O — CID 79641518
1-amino-3-[3-(dimethylamino)piperidin-1-yl]cyclohexane-1-carboxamide (PubChem CID 79641518) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-amino-3-[3-(dimethylamino)piperidin-1-yl]cyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-[3-(dimethylamino)piperidin-1-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79641518 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 1-amino-3-[3-(dimethylamino)piperidin-1-yl]cyclohexane-1-carboxamide |
| SMILES | CN(C)C1CCCN(C2CCCC(N)(C(N)=O)C2)C1 |
| InChI | InChI=1S/C14H28N4O/c1-17(2)12-6-4-8-18(10-12)11-5-3-7-14(16,9-11)13(15)19/h11-12H,3-10,16H2,1-2H3,(H2,15,19) |
| InChIKey | PNAGYMHBGGDKTP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |