C13H25N3O2 — CID 79641851
1-amino-3-[3-(methoxymethyl)pyrrolidin-1-yl]cyclohexane-1-carboxamide (PubChem CID 79641851) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-amino-3-[3-(methoxymethyl)pyrrolidin-1-yl]cyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-[3-(methoxymethyl)pyrrolidin-1-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79641851 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 1-amino-3-[3-(methoxymethyl)pyrrolidin-1-yl]cyclohexane-1-carboxamide |
| SMILES | COCC1CCN(C2CCCC(N)(C(N)=O)C2)C1 |
| InChI | InChI=1S/C13H25N3O2/c1-18-9-10-4-6-16(8-10)11-3-2-5-13(15,7-11)12(14)17/h10-11H,2-9,15H2,1H3,(H2,14,17) |
| InChIKey | PTARFGQDQZLBAA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |