C16H20N4S — CID 79644889
1-(ethylamino)-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]cyclopentane-1-carbonitrile (PubChem CID 79644889) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-(ethylamino)-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]cyclopentane-1-carbonitrile.
| Compound Name | 1-(ethylamino)-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79644889 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-(ethylamino)-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]cyclopentane-1-carbonitrile |
| SMILES | CCNC1(C#N)CCC(Sc2nc3ccc(C)cc3[nH]2)C1 |
| InChI | InChI=1S/C16H20N4S/c1-3-18-16(10-17)7-6-12(9-16)21-15-19-13-5-4-11(2)8-14(13)20-15/h4-5,8,12,18H,3,6-7,9H2,1-2H3,(H,19,20) |
| InChIKey | YENPZEXUPMHMNT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |