C17H31N3O — CID 79646112
3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1-(ethylamino)cyclopentane-1-carboxamide (PubChem CID 79646112) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1-(ethylamino)cyclopentane-1-carboxamide.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1-(ethylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79646112 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1-(ethylamino)cyclopentane-1-carboxamide |
| SMILES | CCNC1(C(N)=O)CCC(N2CCCC3CCCCC32)C1 |
| InChI | InChI=1S/C17H31N3O/c1-2-19-17(16(18)21)10-9-14(12-17)20-11-5-7-13-6-3-4-8-15(13)20/h13-15,19H,2-12H2,1H3,(H2,18,21) |
| InChIKey | DAWRJLPKJJDDNU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |