C15H28N2O2 — CID 79649918
methyl 1-(ethylamino)-3-(2-ethylpyrrolidin-1-yl)cyclopentane-1-carboxylate (PubChem CID 79649918) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is methyl 1-(ethylamino)-3-(2-ethylpyrrolidin-1-yl)cyclopentane-1-carboxylate.
| Compound Name | methyl 1-(ethylamino)-3-(2-ethylpyrrolidin-1-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79649918 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | methyl 1-(ethylamino)-3-(2-ethylpyrrolidin-1-yl)cyclopentane-1-carboxylate |
| SMILES | CCNC1(C(=O)OC)CCC(N2CCCC2CC)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-4-12-7-6-10-17(12)13-8-9-15(11-13,16-5-2)14(18)19-3/h12-13,16H,4-11H2,1-3H3 |
| InChIKey | GDBUVIOTNOZGBH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |