C16H30N2O2 — CID 104691659
methyl 1-amino-3-(2-ethylazepan-1-yl)cyclohexane-1-carboxylate (PubChem CID 104691659) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is methyl 1-amino-3-(2-ethylazepan-1-yl)cyclohexane-1-carboxylate.
| Compound Name | methyl 1-amino-3-(2-ethylazepan-1-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 104691659 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | methyl 1-amino-3-(2-ethylazepan-1-yl)cyclohexane-1-carboxylate |
| SMILES | CCC1CCCCCN1C1CCCC(N)(C(=O)OC)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-3-13-8-5-4-6-11-18(13)14-9-7-10-16(17,12-14)15(19)20-2/h13-14H,3-12,17H2,1-2H3 |
| InChIKey | AAQFOXZEABAJHL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |