C15H30N4O2 — CID 79648094
methyl 1-amino-3-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]cyclopentane-1-carboxylate (PubChem CID 79648094) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is methyl 1-amino-3-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-amino-3-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79648094 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | methyl 1-amino-3-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCC(N2CCN(CCN(C)C)CC2)C1 |
| InChI | InChI=1S/C15H30N4O2/c1-17(2)6-7-18-8-10-19(11-9-18)13-4-5-15(16,12-13)14(20)21-3/h13H,4-12,16H2,1-3H3 |
| InChIKey | RJBGSGFFTFANHL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |