C16H24N2O2 — CID 79649390
1-amino-3-(3-tert-butylphenoxy)cyclopentane-1-carboxamide (PubChem CID 79649390) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-amino-3-(3-tert-butylphenoxy)cyclopentane-1-carboxamide.
| Compound Name | 1-amino-3-(3-tert-butylphenoxy)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79649390 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-amino-3-(3-tert-butylphenoxy)cyclopentane-1-carboxamide |
| SMILES | CC(C)(C)c1cccc(OC2CCC(N)(C(N)=O)C2)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-15(2,3)11-5-4-6-12(9-11)20-13-7-8-16(18,10-13)14(17)19/h4-6,9,13H,7-8,10,18H2,1-3H3,(H2,17,19) |
| InChIKey | GWKMHKBNEHJMAZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |