About 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide
1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide (PubChem CID 79650821) has the molecular formula C8H13N5O
and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide |
| PubChem CID | 79650821 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(N)CCC(n2cncn2)C1 |
| InChI | InChI=1S/C8H13N5O/c9-7(14)8(10)2-1-6(3-8)13-5-11-4-12-13/h4-6H,1-3,10H2,(H2,9,14) |
| InChIKey | ZWWFZGOADAPHHJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide?
The IUPAC name of 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide (CID 79650821) is 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide.
What is the SMILES notation for 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide?
The canonical SMILES for 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide is NC(=O)C1(N)CCC(n2cncn2)C1.
What is the InChIKey of 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide?
The InChIKey is ZWWFZGOADAPHHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O/c9-7(14)8(10)2-1-6(3-8)13-5-11-4-12-13/h4-6H,1-3,10H2,(H2,9,14).
What are the key properties of 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide?
1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide has a molecular weight of 195.23 g/mol, XLogP of -0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(1,2,4-triazol-1-yl)cyclopentane-1-carboxamide is sourced from PubChem (CID 79650821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).