C11H23N3 — CID 79659183
1-(1,4-dimethylpiperazin-2-yl)-N-methylbut-3-en-1-amine (PubChem CID 79659183) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-N-methylbut-3-en-1-amine.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 79659183 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-N-methylbut-3-en-1-amine |
| SMILES | C=CCC(NC)C1CN(C)CCN1C |
| InChI | InChI=1S/C11H23N3/c1-5-6-10(12-2)11-9-13(3)7-8-14(11)4/h5,10-12H,1,6-9H2,2-4H3 |
| InChIKey | FQBMOFTWICKDEO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|