About 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine
1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine (PubChem CID 107896718) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine |
| PubChem CID | 107896718 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine |
| SMILES | CCCC(C)C(NC)C1CN(C)CCN1C |
| InChI | InChI=1S/C13H29N3/c1-6-7-11(2)13(14-3)12-10-15(4)8-9-16(12)5/h11-14H,6-10H2,1-5H3 |
| InChIKey | PTZNFTVQTGUDQE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine?
The IUPAC name of 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine (CID 107896718) is 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine.
What is the SMILES notation for 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine?
The canonical SMILES for 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine is CCCC(C)C(NC)C1CN(C)CCN1C.
What is the InChIKey of 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine?
The InChIKey is PTZNFTVQTGUDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3/c1-6-7-11(2)13(14-3)12-10-15(4)8-9-16(12)5/h11-14H,6-10H2,1-5H3.
What are the key properties of 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine?
1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine has a molecular weight of 227.40 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dimethylpiperazin-2-yl)-N,2-dimethylpentan-1-amine is sourced from PubChem (CID 107896718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).