C11H25N3 — CID 79659340
1-(1,4-dimethylpiperazin-2-yl)-2-methylbutan-1-amine (PubChem CID 79659340) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-2-methylbutan-1-amine.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 79659340 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-2-methylbutan-1-amine |
| SMILES | CCC(C)C(N)C1CN(C)CCN1C |
| InChI | InChI=1S/C11H25N3/c1-5-9(2)11(12)10-8-13(3)6-7-14(10)4/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | JGXDLUOQMWSYNP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |