C9H21N3O — CID 79659006
1-(1,4-dimethylpiperazin-2-yl)-2-methoxyethanamine (PubChem CID 79659006) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-2-methoxyethanamine.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 79659006 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-2-methoxyethanamine |
| SMILES | COCC(N)C1CN(C)CCN1C |
| InChI | InChI=1S/C9H21N3O/c1-11-4-5-12(2)9(6-11)8(10)7-13-3/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | IACIYOUAIKZJSG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |