About 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol
1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol (PubChem CID 63930922) has the molecular formula C11H25N3O2
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol |
| PubChem CID | 63930922 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CNCC1CN(C)CCN1C |
| InChI | InChI=1S/C11H25N3O2/c1-13-4-5-14(2)10(8-13)6-12-7-11(15)9-16-3/h10-12,15H,4-9H2,1-3H3 |
| InChIKey | MWEDDKZYQYYSHW-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol (CID 63930922) is 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol is COCC(O)CNCC1CN(C)CCN1C.
What is the InChIKey of 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol?
The InChIKey is MWEDDKZYQYYSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O2/c1-13-4-5-14(2)10(8-13)6-12-7-11(15)9-16-3/h10-12,15H,4-9H2,1-3H3.
What are the key properties of 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol?
1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol has a molecular weight of 231.34 g/mol, XLogP of -1.17, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,4-dimethylpiperazin-2-yl)methylamino]-3-methoxypropan-2-ol is sourced from PubChem (CID 63930922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).