C12H27N3O — CID 114856805
1-(1,4-dimethyl-1,4-diazepan-2-yl)-4-methoxybutan-1-amine (PubChem CID 114856805) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-(1,4-dimethyl-1,4-diazepan-2-yl)-4-methoxybutan-1-amine.
| Compound Name | 1-(1,4-dimethyl-1,4-diazepan-2-yl)-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 114856805 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 1-(1,4-dimethyl-1,4-diazepan-2-yl)-4-methoxybutan-1-amine |
| SMILES | COCCCC(N)C1CN(C)CCCN1C |
| InChI | InChI=1S/C12H27N3O/c1-14-7-5-8-15(2)12(10-14)11(13)6-4-9-16-3/h11-12H,4-10,13H2,1-3H3 |
| InChIKey | JGECQNKBIVLYBB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|