C14H14ClN3OS2 — CID 7966014
1-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3-(3-methoxyphenyl)thiourea (PubChem CID 7966014) has the molecular formula C14H14ClN3OS2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 1-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 7966014 |
| Molecular Formula | C14H14ClN3OS2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 1-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N/N=C(/C)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C14H14ClN3OS2/c1-9(12-6-7-13(15)21-12)17-18-14(20)16-10-4-3-5-11(8-10)19-2/h3-8H,1-2H3,(H2,16,18,20)/b17-9- |
| InChIKey | UAUZTIQEWCGAOM-MFOYZWKCSA-N |
| XLogP | 4.12 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|