C14H14ClN3S2 — CID 7933526
1-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3-(2-methylphenyl)thiourea (PubChem CID 7933526) has the molecular formula C14H14ClN3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is 1-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 7933526 |
| Molecular Formula | C14H14ClN3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-[(Z)-1-(5-chlorothiophen-2-yl)ethylideneamino]-3-(2-methylphenyl)thiourea |
| SMILES | C/C(=N/NC(=S)Nc1ccccc1C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H14ClN3S2/c1-9-5-3-4-6-11(9)16-14(19)18-17-10(2)12-7-8-13(15)20-12/h3-8H,1-2H3,(H2,16,18,19)/b17-10- |
| InChIKey | PDXIZLAPGAZKSX-YVLHZVERSA-N |
| XLogP | 4.42 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|