C16H17N3O3S — CID 135770238
1-(2-methylphenyl)-3-[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]thiourea (PubChem CID 135770238) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 135770238 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(E)-1-(2,3,4-trihydroxyphenyl)ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(=S)Nc1ccccc1C)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C16H17N3O3S/c1-9-5-3-4-6-12(9)17-16(23)19-18-10(2)11-7-8-13(20)15(22)14(11)21/h3-8,20-22H,1-2H3,(H2,17,19,23)/b18-10+ |
| InChIKey | VXGUYBUXZJHVKM-VCHYOVAHSA-N |
| XLogP | 2.82 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|