C10H5F4N3 — CID 79660838
2-(1,1,2,2-tetrafluoroethyl)-3H-benzimidazole-5-carbonitrile (PubChem CID 79660838) has the molecular formula C10H5F4N3 and a molecular weight of 243.16 g/mol. Its IUPAC name is 2-(1,1,2,2-tetrafluoroethyl)-3H-benzimidazole-5-carbonitrile.
| Compound Name | 2-(1,1,2,2-tetrafluoroethyl)-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 79660838 |
| Molecular Formula | C10H5F4N3 |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-(1,1,2,2-tetrafluoroethyl)-3H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(C(F)(F)C(F)F)[nH]c2c1 |
| InChI | InChI=1S/C10H5F4N3/c11-8(12)10(13,14)9-16-6-2-1-5(4-15)3-7(6)17-9/h1-3,8H,(H,16,17) |
| InChIKey | KSXGTTYUGWEPKU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|