C11H13F4NO — CID 79660894
2,2,3,3-tetrafluoro-1-(2-methoxy-5-methylphenyl)propan-1-amine (PubChem CID 79660894) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-(2-methoxy-5-methylphenyl)propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-1-(2-methoxy-5-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 79660894 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-(2-methoxy-5-methylphenyl)propan-1-amine |
| SMILES | COc1ccc(C)cc1C(N)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H13F4NO/c1-6-3-4-8(17-2)7(5-6)9(16)11(14,15)10(12)13/h3-5,9-10H,16H2,1-2H3 |
| InChIKey | UTAJKXICHOUXKM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|