C16H17N5S — CID 7966290
N-[(Z)-1-(3-aminophenyl)ethylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 7966290) has the molecular formula C16H17N5S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[(Z)-1-(3-aminophenyl)ethylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(Z)-1-(3-aminophenyl)ethylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 7966290 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[(Z)-1-(3-aminophenyl)ethylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C/C(=N/Nc1ncnc2sc(C)c(C)c12)c1cccc(N)c1 |
| InChI | InChI=1S/C16H17N5S/c1-9-11(3)22-16-14(9)15(18-8-19-16)21-20-10(2)12-5-4-6-13(17)7-12/h4-8H,17H2,1-3H3,(H,18,19,21)/b20-10- |
| InChIKey | REUAOPMNSQCFPK-JMIUGGIZSA-N |
| XLogP | 3.73 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|