C20H17N5S — CID 9257586
N-[(Z)-1-(3-aminophenyl)ethylideneamino]-6-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 9257586) has the molecular formula C20H17N5S and a molecular weight of 359.46 g/mol. Its IUPAC name is N-[(Z)-1-(3-aminophenyl)ethylideneamino]-6-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(Z)-1-(3-aminophenyl)ethylideneamino]-6-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9257586 |
| Molecular Formula | C20H17N5S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-[(Z)-1-(3-aminophenyl)ethylideneamino]-6-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C/C(=N/Nc1ncnc2sc(-c3ccccc3)cc12)c1cccc(N)c1 |
| InChI | InChI=1S/C20H17N5S/c1-13(15-8-5-9-16(21)10-15)24-25-19-17-11-18(14-6-3-2-4-7-14)26-20(17)23-12-22-19/h2-12H,21H2,1H3,(H,22,23,25)/b24-13- |
| InChIKey | OCJIBKKDFHJALX-CFRMEGHHSA-N |
| XLogP | 4.78 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|