C12H22N4O2S — CID 79663860
N-(2-methoxyethyl)-3-(4-propan-2-ylmorpholin-2-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 79663860) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(4-propan-2-ylmorpholin-2-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-methoxyethyl)-3-(4-propan-2-ylmorpholin-2-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 79663860 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(2-methoxyethyl)-3-(4-propan-2-ylmorpholin-2-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | COCCNc1nc(C2CN(C(C)C)CCO2)ns1 |
| InChI | InChI=1S/C12H22N4O2S/c1-9(2)16-5-7-18-10(8-16)11-14-12(19-15-11)13-4-6-17-3/h9-10H,4-8H2,1-3H3,(H,13,14,15) |
| InChIKey | RJORHGNWMDYIRH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|