C10H18N4OS — CID 79669066
N-ethyl-3-(4-ethylmorpholin-2-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 79669066) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is N-ethyl-3-(4-ethylmorpholin-2-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-ethyl-3-(4-ethylmorpholin-2-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 79669066 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-ethyl-3-(4-ethylmorpholin-2-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCNc1nc(C2CN(CC)CCO2)ns1 |
| InChI | InChI=1S/C10H18N4OS/c1-3-11-10-12-9(13-16-10)8-7-14(4-2)5-6-15-8/h8H,3-7H2,1-2H3,(H,11,12,13) |
| InChIKey | GVFDLMFKYJYLPI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |