C14H26N6 — CID 79667141
[6-tert-butyl-2-(1,4-dimethylpiperazin-2-yl)pyrimidin-4-yl]hydrazine (PubChem CID 79667141) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is [6-tert-butyl-2-(1,4-dimethylpiperazin-2-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-tert-butyl-2-(1,4-dimethylpiperazin-2-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79667141 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | [6-tert-butyl-2-(1,4-dimethylpiperazin-2-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CN1CCN(C)C(c2nc(NN)cc(C(C)(C)C)n2)C1 |
| InChI | InChI=1S/C14H26N6/c1-14(2,3)11-8-12(18-15)17-13(16-11)10-9-19(4)6-7-20(10)5/h8,10H,6-7,9,15H2,1-5H3,(H,16,17,18) |
| InChIKey | XYXDMMYNJWEUID-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|