C13H23N3O2S — CID 79667815
2,2-dimethyl-N'-[(5-nitrothiophen-3-yl)methyl]-N'-propylpropane-1,3-diamine (PubChem CID 79667815) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 2,2-dimethyl-N'-[(5-nitrothiophen-3-yl)methyl]-N'-propylpropane-1,3-diamine.
| Compound Name | 2,2-dimethyl-N'-[(5-nitrothiophen-3-yl)methyl]-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79667815 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2,2-dimethyl-N'-[(5-nitrothiophen-3-yl)methyl]-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(Cc1csc([N+](=O)[O-])c1)CC(C)(C)CN |
| InChI | InChI=1S/C13H23N3O2S/c1-4-5-15(10-13(2,3)9-14)7-11-6-12(16(17)18)19-8-11/h6,8H,4-5,7,9-10,14H2,1-3H3 |
| InChIKey | YLPKMRTVNRLXGV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|