C15H27NO4S — CID 79671934
methyl 1-(cyclopropylamino)-2-[2-(2,3-dihydroxypropylsulfanyl)ethyl]cyclopentane-1-carboxylate (PubChem CID 79671934) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is methyl 1-(cyclopropylamino)-2-[2-(2,3-dihydroxypropylsulfanyl)ethyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-(cyclopropylamino)-2-[2-(2,3-dihydroxypropylsulfanyl)ethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79671934 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | methyl 1-(cyclopropylamino)-2-[2-(2,3-dihydroxypropylsulfanyl)ethyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC2CC2)CCCC1CCSCC(O)CO |
| InChI | InChI=1S/C15H27NO4S/c1-20-14(19)15(16-12-4-5-12)7-2-3-11(15)6-8-21-10-13(18)9-17/h11-13,16-18H,2-10H2,1H3 |
| InChIKey | ZACCLENWTXELCL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|