C11H25NO2S — CID 79672307
3-[3-(propylamino)pentan-2-ylsulfanyl]propane-1,2-diol (PubChem CID 79672307) has the molecular formula C11H25NO2S and a molecular weight of 235.39 g/mol. Its IUPAC name is 3-[3-(propylamino)pentan-2-ylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[3-(propylamino)pentan-2-ylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 79672307 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-[3-(propylamino)pentan-2-ylsulfanyl]propane-1,2-diol |
| SMILES | CCCNC(CC)C(C)SCC(O)CO |
| InChI | InChI=1S/C11H25NO2S/c1-4-6-12-11(5-2)9(3)15-8-10(14)7-13/h9-14H,4-8H2,1-3H3 |
| InChIKey | NWAZRDLTQDTXNH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |