About 5-benzylpyridin-3-ol
5-benzylpyridin-3-ol (PubChem CID 796726) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-benzylpyridin-3-ol.
Molecular Properties
| Compound Name | 5-benzylpyridin-3-ol |
| PubChem CID | 796726 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-benzylpyridin-3-ol |
| SMILES | Oc1cncc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C12H11NO/c14-12-7-11(8-13-9-12)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2 |
| InChIKey | BBQJCGXVQMUHAR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylpyridin-3-ol?
The IUPAC name of 5-benzylpyridin-3-ol (CID 796726) is 5-benzylpyridin-3-ol.
What is the SMILES notation for 5-benzylpyridin-3-ol?
The canonical SMILES for 5-benzylpyridin-3-ol is Oc1cncc(Cc2ccccc2)c1.
What is the InChIKey of 5-benzylpyridin-3-ol?
The InChIKey is BBQJCGXVQMUHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c14-12-7-11(8-13-9-12)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2.
What are the key properties of 5-benzylpyridin-3-ol?
5-benzylpyridin-3-ol has a molecular weight of 185.23 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylpyridin-3-ol is sourced from PubChem (CID 796726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).