C11H22N2O2 — CID 79678596
4-(3,3-dimethoxyazetidin-1-yl)cyclohexan-1-amine (PubChem CID 79678596) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-(3,3-dimethoxyazetidin-1-yl)cyclohexan-1-amine.
| Compound Name | 4-(3,3-dimethoxyazetidin-1-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 79678596 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4-(3,3-dimethoxyazetidin-1-yl)cyclohexan-1-amine |
| SMILES | COC1(OC)CN(C2CCC(N)CC2)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-14-11(15-2)7-13(8-11)10-5-3-9(12)4-6-10/h9-10H,3-8,12H2,1-2H3 |
| InChIKey | TWJUPEYCUGFFAH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|