3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid

C12H21NO4 — CID 79695707

IUPAC3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid
SMILESCOC1(OC)CN(C2CCCC(C(=O)O)C2)C1
InChIInChI=1S/C12H21NO4/c1-16-12(17-2)7-13(8-12)10-5-3-4-9(6-10)11(14)15/h9-10H,3-8H2,1-2H3,(H,14,15)
InChIKeyRCNNKYPLAGDROQ-UHFFFAOYSA-N
MW243.30 g/mol
LogP0.93
Rot. Bonds4

About 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid

3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 79695707) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid
PubChem CID79695707
Molecular FormulaC12H21NO4
Molecular Weight243.30 g/mol
Exact Mass243.15
IUPAC Name3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid
SMILESCOC1(OC)CN(C2CCCC(C(=O)O)C2)C1
InChIInChI=1S/C12H21NO4/c1-16-12(17-2)7-13(8-12)10-5-3-4-9(6-10)11(14)15/h9-10H,3-8H2,1-2H3,(H,14,15)
InChIKeyRCNNKYPLAGDROQ-UHFFFAOYSA-N
XLogP0.93
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.30
LogP ≤ 50.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid?
The IUPAC name of 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid (CID 79695707) is 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid is COC1(OC)CN(C2CCCC(C(=O)O)C2)C1.
What is the InChIKey of 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid?
The InChIKey is RCNNKYPLAGDROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4/c1-16-12(17-2)7-13(8-12)10-5-3-4-9(6-10)11(14)15/h9-10H,3-8H2,1-2H3,(H,14,15).
What are the key properties of 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid?
3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid has a molecular weight of 243.30 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethoxyazetidin-1-yl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 79695707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).