C14H23ClN2O — CID 79678939
1-[[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine (PubChem CID 79678939) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 1-[[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine.
| Compound Name | 1-[[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine |
|---|---|
| PubChem CID | 79678939 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine |
| SMILES | Cc1cc(C)c(CCl)c(OCC(C)(C)N(C)C)n1 |
| InChI | InChI=1S/C14H23ClN2O/c1-10-7-11(2)16-13(12(10)8-15)18-9-14(3,4)17(5)6/h7H,8-9H2,1-6H3 |
| InChIKey | XLELUBQUEYIMPH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|