C10H18N6O — CID 79680379
4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]morpholine-2-carboximidamide (PubChem CID 79680379) has the molecular formula C10H18N6O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]morpholine-2-carboximidamide.
| Compound Name | 4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79680379 |
| Molecular Formula | C10H18N6O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]morpholine-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1CN(Cc2ncnn2CC)CCO1 |
| InChI | InChI=1S/C10H18N6O/c1-2-16-9(13-7-14-16)6-15-3-4-17-8(5-15)10(11)12/h7-8H,2-6H2,1H3,(H3,11,12) |
| InChIKey | CSLCGNZMOBONLQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|