C13H16N4OS2 — CID 79680495
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)morpholine-2-carbothioamide (PubChem CID 79680495) has the molecular formula C13H16N4OS2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)morpholine-2-carbothioamide.
| Compound Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)morpholine-2-carbothioamide |
|---|---|
| PubChem CID | 79680495 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)morpholine-2-carbothioamide |
| SMILES | Cc1sc2ncnc(N3CCOC(C(N)=S)C3)c2c1C |
| InChI | InChI=1S/C13H16N4OS2/c1-7-8(2)20-13-10(7)12(15-6-16-13)17-3-4-18-9(5-17)11(14)19/h6,9H,3-5H2,1-2H3,(H2,14,19) |
| InChIKey | WSXAXXUMPNFBSJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|