C10H16N4OS — CID 79681005
4-[(2-methyl-1,3-thiazol-4-yl)methyl]morpholine-2-carboximidamide (PubChem CID 79681005) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methyl]morpholine-2-carboximidamide.
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79681005 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]morpholine-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1CN(Cc2csc(C)n2)CCO1 |
| InChI | InChI=1S/C10H16N4OS/c1-7-13-8(6-16-7)4-14-2-3-15-9(5-14)10(11)12/h6,9H,2-5H2,1H3,(H3,11,12) |
| InChIKey | CYZIIXJEMLEXMM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|