C8H14F3N3O2 — CID 79681419
N'-hydroxy-4-(3,3,3-trifluoropropyl)morpholine-2-carboximidamide (PubChem CID 79681419) has the molecular formula C8H14F3N3O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is N'-hydroxy-4-(3,3,3-trifluoropropyl)morpholine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-(3,3,3-trifluoropropyl)morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79681419 |
| Molecular Formula | C8H14F3N3O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N'-hydroxy-4-(3,3,3-trifluoropropyl)morpholine-2-carboximidamide |
| SMILES | NC(=NO)C1CN(CCC(F)(F)F)CCO1 |
| InChI | InChI=1S/C8H14F3N3O2/c9-8(10,11)1-2-14-3-4-16-6(5-14)7(12)13-15/h6,15H,1-5H2,(H2,12,13) |
| InChIKey | DXTARQILGDSPPN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|