C12H18O4S2 — CID 79682734
3-(4-propylsulfonylphenyl)sulfanylpropane-1,2-diol (PubChem CID 79682734) has the molecular formula C12H18O4S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-(4-propylsulfonylphenyl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(4-propylsulfonylphenyl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79682734 |
| Molecular Formula | C12H18O4S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-(4-propylsulfonylphenyl)sulfanylpropane-1,2-diol |
| SMILES | CCCS(=O)(=O)c1ccc(SCC(O)CO)cc1 |
| InChI | InChI=1S/C12H18O4S2/c1-2-7-18(15,16)12-5-3-11(4-6-12)17-9-10(14)8-13/h3-6,10,13-14H,2,7-9H2,1H3 |
| InChIKey | QHYPLUJTIOCEQW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |