C10H14N2O3S — CID 79683151
4-(2,3-dihydroxypropylsulfanyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 79683151) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfanyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(2,3-dihydroxypropylsulfanyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 79683151 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-(2,3-dihydroxypropylsulfanyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(SCC(O)CO)cc1 |
| InChI | InChI=1S/C10H14N2O3S/c11-10(12-15)7-1-3-9(4-2-7)16-6-8(14)5-13/h1-4,8,13-15H,5-6H2,(H2,11,12) |
| InChIKey | VRXYNDAEGUYFCR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|