C10H13ClN2O2S — CID 79683366
4-chloro-2-(2,3-dihydroxypropylsulfanyl)benzenecarboximidamide (PubChem CID 79683366) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dihydroxypropylsulfanyl)benzenecarboximidamide.
| Compound Name | 4-chloro-2-(2,3-dihydroxypropylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 79683366 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-chloro-2-(2,3-dihydroxypropylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cl)cc1SCC(O)CO |
| InChI | InChI=1S/C10H13ClN2O2S/c11-6-1-2-8(10(12)13)9(3-6)16-5-7(15)4-14/h1-3,7,14-15H,4-5H2,(H3,12,13) |
| InChIKey | LFAFAACXOGSDLL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|