C23H25NO5 — CID 7968492
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-oxochromene-2-carboxylate (PubChem CID 7968492) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-oxochromene-2-carboxylate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 7968492 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-oxochromene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(=O)c2ccccc2o1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H25NO5/c1-13(21(26)24-23-10-14-6-15(11-23)8-16(7-14)12-23)28-22(27)20-9-18(25)17-4-2-3-5-19(17)29-20/h2-5,9,13-16H,6-8,10-12H2,1H3,(H,24,26)/t13-,14?,15?,16?,23?/m0/s1 |
| InChIKey | MSJZWBPXJUYRQT-HDDXYUSQSA-N |
| XLogP | 3.42 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |