C24H29NO5 — CID 7551327
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 7551327) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7551327 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | COCc1c(C(=O)O[C@@H](C)C(=O)NC23CC4CC(CC(C4)C2)C3)oc2ccccc12 |
| InChI | InChI=1S/C24H29NO5/c1-14(22(26)25-24-10-15-7-16(11-24)9-17(8-15)12-24)29-23(27)21-19(13-28-2)18-5-3-4-6-20(18)30-21/h3-6,14-17H,7-13H2,1-2H3,(H,25,26)/t14-,15?,16?,17?,24?/m0/s1 |
| InChIKey | DINSUAKBGCJLNP-IOAHRDFVSA-N |
| XLogP | 4.21 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |