C18H30N2 — CID 79686737
N-[1-[4-(3-tert-butylazetidin-1-yl)phenyl]ethyl]propan-1-amine (PubChem CID 79686737) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N-[1-[4-(3-tert-butylazetidin-1-yl)phenyl]ethyl]propan-1-amine.
| Compound Name | N-[1-[4-(3-tert-butylazetidin-1-yl)phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79686737 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N-[1-[4-(3-tert-butylazetidin-1-yl)phenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(N2CC(C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C18H30N2/c1-6-11-19-14(2)15-7-9-17(10-8-15)20-12-16(13-20)18(3,4)5/h7-10,14,16,19H,6,11-13H2,1-5H3 |
| InChIKey | KLXPSFLZWKQIFD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|