C15H15BrINO2S — CID 79691117
N-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-iodothiophen-3-yl)methyl]ethanamine (PubChem CID 79691117) has the molecular formula C15H15BrINO2S and a molecular weight of 480.17 g/mol. Its IUPAC name is N-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-iodothiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-iodothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79691117 |
| Molecular Formula | C15H15BrINO2S |
| Molecular Weight | 480.17 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | N-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-iodothiophen-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1csc(I)c1)c1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C15H15BrINO2S/c1-2-18-15(9-5-14(17)21-8-9)10-6-12-13(7-11(10)16)20-4-3-19-12/h5-8,15,18H,2-4H2,1H3 |
| InChIKey | DSHJSWOUSPTKIN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.17 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|