C15H14IN3OS — CID 79691856
5-(5-iodothiophen-3-yl)-4-(2-methoxy-5-methylphenyl)-1H-pyrazol-3-amine (PubChem CID 79691856) has the molecular formula C15H14IN3OS and a molecular weight of 411.27 g/mol. Its IUPAC name is 5-(5-iodothiophen-3-yl)-4-(2-methoxy-5-methylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(5-iodothiophen-3-yl)-4-(2-methoxy-5-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 79691856 |
| Molecular Formula | C15H14IN3OS |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 5-(5-iodothiophen-3-yl)-4-(2-methoxy-5-methylphenyl)-1H-pyrazol-3-amine |
| SMILES | COc1ccc(C)cc1-c1c(N)n[nH]c1-c1csc(I)c1 |
| InChI | InChI=1S/C15H14IN3OS/c1-8-3-4-11(20-2)10(5-8)13-14(18-19-15(13)17)9-6-12(16)21-7-9/h3-7H,1-2H3,(H3,17,18,19) |
| InChIKey | QQDQEQSHMGUSEH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|