C15H14ClN3OS — CID 80644038
5-(3-chlorothiophen-2-yl)-4-(2-methoxy-5-methylphenyl)-1H-pyrazol-3-amine (PubChem CID 80644038) has the molecular formula C15H14ClN3OS and a molecular weight of 319.82 g/mol. Its IUPAC name is 5-(3-chlorothiophen-2-yl)-4-(2-methoxy-5-methylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(3-chlorothiophen-2-yl)-4-(2-methoxy-5-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 80644038 |
| Molecular Formula | C15H14ClN3OS |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 5-(3-chlorothiophen-2-yl)-4-(2-methoxy-5-methylphenyl)-1H-pyrazol-3-amine |
| SMILES | COc1ccc(C)cc1-c1c(N)n[nH]c1-c1sccc1Cl |
| InChI | InChI=1S/C15H14ClN3OS/c1-8-3-4-11(20-2)9(7-8)12-13(18-19-15(12)17)14-10(16)5-6-21-14/h3-7H,1-2H3,(H3,17,18,19) |
| InChIKey | XTQADTGAWKWKMC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |