C16H18N2OS2 — CID 79691917
5-(3-aminoprop-1-ynyl)-N-[1-(5-methylthiophen-2-yl)propan-2-yl]thiophene-3-carboxamide (PubChem CID 79691917) has the molecular formula C16H18N2OS2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N-[1-(5-methylthiophen-2-yl)propan-2-yl]thiophene-3-carboxamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N-[1-(5-methylthiophen-2-yl)propan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79691917 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N-[1-(5-methylthiophen-2-yl)propan-2-yl]thiophene-3-carboxamide |
| SMILES | Cc1ccc(CC(C)NC(=O)c2csc(C#CCN)c2)s1 |
| InChI | InChI=1S/C16H18N2OS2/c1-11(8-15-6-5-12(2)21-15)18-16(19)13-9-14(20-10-13)4-3-7-17/h5-6,9-11H,7-8,17H2,1-2H3,(H,18,19) |
| InChIKey | DKCAWTGNXPXIEZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|