C12H14N2O3S — CID 79684750
methyl 2-[[5-(3-aminoprop-1-ynyl)thiophene-3-carbonyl]amino]propanoate (PubChem CID 79684750) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 2-[[5-(3-aminoprop-1-ynyl)thiophene-3-carbonyl]amino]propanoate.
| Compound Name | methyl 2-[[5-(3-aminoprop-1-ynyl)thiophene-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 79684750 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | methyl 2-[[5-(3-aminoprop-1-ynyl)thiophene-3-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)c1csc(C#CCN)c1 |
| InChI | InChI=1S/C12H14N2O3S/c1-8(12(16)17-2)14-11(15)9-6-10(18-7-9)4-3-5-13/h6-8H,5,13H2,1-2H3,(H,14,15) |
| InChIKey | NPTFUMVTLDIZAC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|