C11H12N2O3S — CID 79696589
methyl 2-[[5-(3-aminoprop-1-ynyl)thiophene-3-carbonyl]amino]acetate (PubChem CID 79696589) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is methyl 2-[[5-(3-aminoprop-1-ynyl)thiophene-3-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[5-(3-aminoprop-1-ynyl)thiophene-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 79696589 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | methyl 2-[[5-(3-aminoprop-1-ynyl)thiophene-3-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1csc(C#CCN)c1 |
| InChI | InChI=1S/C11H12N2O3S/c1-16-10(14)6-13-11(15)8-5-9(17-7-8)3-2-4-12/h5,7H,4,6,12H2,1H3,(H,13,15) |
| InChIKey | BHAZURJCUJGZAF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|